About prop-1-ene;trimethyl(propyl)silane;trimethylsilane
prop-1-ene;trimethyl(propyl)silane;trimethylsilane (PubChem CID 159565354) has the molecular formula C12H32Si2
and a molecular weight of 232.56 g/mol. Its IUPAC name is prop-1-ene;trimethyl(propyl)silane;trimethylsilane.
Molecular Properties
| Compound Name | prop-1-ene;trimethyl(propyl)silane;trimethylsilane |
| PubChem CID | 159565354 |
| Molecular Formula | C12H32Si2 |
| Molecular Weight | 232.56 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | prop-1-ene;trimethyl(propyl)silane;trimethylsilane |
| SMILES | C=CC.CCC[Si](C)(C)C.C[SiH](C)C |
| InChI | InChI=1S/C6H16Si.C3H10Si.C3H6/c1-5-6-7(2,3)4;1-4(2)3;1-3-2/h5-6H2,1-4H3;4H,1-3H3;3H,1H2,2H3 |
| InChIKey | MHCZBCVRNIGCGT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ene;trimethyl(propyl)silane;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ene;trimethyl(propyl)silane;trimethylsilane?
The IUPAC name of prop-1-ene;trimethyl(propyl)silane;trimethylsilane (CID 159565354) is prop-1-ene;trimethyl(propyl)silane;trimethylsilane.
What is the SMILES notation for prop-1-ene;trimethyl(propyl)silane;trimethylsilane?
The canonical SMILES for prop-1-ene;trimethyl(propyl)silane;trimethylsilane is C=CC.CCC[Si](C)(C)C.C[SiH](C)C.
What is the InChIKey of prop-1-ene;trimethyl(propyl)silane;trimethylsilane?
The InChIKey is MHCZBCVRNIGCGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16Si.C3H10Si.C3H6/c1-5-6-7(2,3)4;1-4(2)3;1-3-2/h5-6H2,1-4H3;4H,1-3H3;3H,1H2,2H3.
What are the key properties of prop-1-ene;trimethyl(propyl)silane;trimethylsilane?
prop-1-ene;trimethyl(propyl)silane;trimethylsilane has a molecular weight of 232.56 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ene;trimethyl(propyl)silane;trimethylsilane is sourced from PubChem (CID 159565354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).