About but-3-enyl-dimethylsilyl-dimethylsilane
but-3-enyl-dimethylsilyl-dimethylsilane (PubChem CID 71327243) has the molecular formula C8H20Si2
and a molecular weight of 172.42 g/mol. Its IUPAC name is but-3-enyl-dimethylsilyl-dimethylsilane.
Molecular Properties
| Compound Name | but-3-enyl-dimethylsilyl-dimethylsilane |
| PubChem CID | 71327243 |
| Molecular Formula | C8H20Si2 |
| Molecular Weight | 172.42 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | but-3-enyl-dimethylsilyl-dimethylsilane |
| SMILES | C=CCC[Si](C)(C)[SiH](C)C |
| InChI | InChI=1S/C8H20Si2/c1-6-7-8-10(4,5)9(2)3/h6,9H,1,7-8H2,2-5H3 |
| InChIKey | DQPWUJOODUVEQY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl-dimethylsilyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl-dimethylsilyl-dimethylsilane?
The IUPAC name of but-3-enyl-dimethylsilyl-dimethylsilane (CID 71327243) is but-3-enyl-dimethylsilyl-dimethylsilane.
What is the SMILES notation for but-3-enyl-dimethylsilyl-dimethylsilane?
The canonical SMILES for but-3-enyl-dimethylsilyl-dimethylsilane is C=CCC[Si](C)(C)[SiH](C)C.
What is the InChIKey of but-3-enyl-dimethylsilyl-dimethylsilane?
The InChIKey is DQPWUJOODUVEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20Si2/c1-6-7-8-10(4,5)9(2)3/h6,9H,1,7-8H2,2-5H3.
What are the key properties of but-3-enyl-dimethylsilyl-dimethylsilane?
but-3-enyl-dimethylsilyl-dimethylsilane has a molecular weight of 172.42 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl-dimethylsilyl-dimethylsilane is sourced from PubChem (CID 71327243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).