About ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane
ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane (PubChem CID 157309689) has the molecular formula C16H44Si4
and a molecular weight of 348.87 g/mol. Its IUPAC name is ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane.
Molecular Properties
| Compound Name | ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane |
| PubChem CID | 157309689 |
| Molecular Formula | C16H44Si4 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane |
| SMILES | C=C[Si](C)(C)C.C[SiH](C)C.C[Si](C)(C)CC[Si](C)(C)C |
| InChI | InChI=1S/C8H22Si2.C5H12Si.C3H10Si/c1-9(2,3)7-8-10(4,5)6;1-5-6(2,3)4;1-4(2)3/h7-8H2,1-6H3;5H,1H2,2-4H3;4H,1-3H3 |
| InChIKey | BCWXGZUVZHDVFH-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane?
The IUPAC name of ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane (CID 157309689) is ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane.
What is the SMILES notation for ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane?
The canonical SMILES for ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane is C=C[Si](C)(C)C.C[SiH](C)C.C[Si](C)(C)CC[Si](C)(C)C.
What is the InChIKey of ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane?
The InChIKey is BCWXGZUVZHDVFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H22Si2.C5H12Si.C3H10Si/c1-9(2,3)7-8-10(4,5)6;1-5-6(2,3)4;1-4(2)3/h7-8H2,1-6H3;5H,1H2,2-4H3;4H,1-3H3.
What are the key properties of ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane?
ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane has a molecular weight of 348.87 g/mol, XLogP of 6.82, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane is sourced from PubChem (CID 157309689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).