C16H44Si4 — CID 157309689
ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane (PubChem CID 157309689) has the molecular formula C16H44Si4 and a molecular weight of 348.87 g/mol. Its IUPAC name is ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane.
| Compound Name | ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane |
|---|---|
| PubChem CID | 157309689 |
| Molecular Formula | C16H44Si4 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | ethenyl(trimethyl)silane;trimethylsilane;trimethyl(2-trimethylsilylethyl)silane |
| SMILES | C=C[Si](C)(C)C.C[SiH](C)C.C[Si](C)(C)CC[Si](C)(C)C |
| InChI | InChI=1S/C8H22Si2.C5H12Si.C3H10Si/c1-9(2,3)7-8-10(4,5)6;1-5-6(2,3)4;1-4(2)3/h7-8H2,1-6H3;5H,1H2,2-4H3;4H,1-3H3 |
| InChIKey | BCWXGZUVZHDVFH-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|