C9H22OSi2 — CID 123866825
[dimethyl(propyl)silyl]oxy-ethenyl-dimethylsilane (PubChem CID 123866825) has the molecular formula C9H22OSi2 and a molecular weight of 202.45 g/mol. Its IUPAC name is [dimethyl(propyl)silyl]oxy-ethenyl-dimethylsilane.
| Compound Name | [dimethyl(propyl)silyl]oxy-ethenyl-dimethylsilane |
|---|---|
| PubChem CID | 123866825 |
| Molecular Formula | C9H22OSi2 |
| Molecular Weight | 202.45 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | [dimethyl(propyl)silyl]oxy-ethenyl-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)CCC |
| InChI | InChI=1S/C9H22OSi2/c1-7-9-12(5,6)10-11(3,4)8-2/h8H,2,7,9H2,1,3-6H3 |
| InChIKey | HZYINRQZURZYHN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|