C12H27ClO2Si3 — CID 154409896
3-chloropropyl-bis[[ethenyl(dimethyl)silyl]oxy]-methylsilane (PubChem CID 154409896) has the molecular formula C12H27ClO2Si3 and a molecular weight of 323.06 g/mol. Its IUPAC name is 3-chloropropyl-bis[[ethenyl(dimethyl)silyl]oxy]-methylsilane.
| Compound Name | 3-chloropropyl-bis[[ethenyl(dimethyl)silyl]oxy]-methylsilane |
|---|---|
| PubChem CID | 154409896 |
| Molecular Formula | C12H27ClO2Si3 |
| Molecular Weight | 323.06 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-chloropropyl-bis[[ethenyl(dimethyl)silyl]oxy]-methylsilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(CCCCl)O[Si](C)(C)C=C |
| InChI | InChI=1S/C12H27ClO2Si3/c1-8-16(3,4)14-18(7,12-10-11-13)15-17(5,6)9-2/h8-9H,1-2,10-12H2,3-7H3 |
| InChIKey | WNZSODFVJQXTLQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.06 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|