C13H29ClO3Si3 — CID 123218090
[5-chloro-2-[ethenyl(dimethyl)silyl]oxy-1-silyloxypentan-2-yl]oxy-ethenyl-dimethylsilane (PubChem CID 123218090) has the molecular formula C13H29ClO3Si3 and a molecular weight of 353.08 g/mol. Its IUPAC name is [5-chloro-2-[ethenyl(dimethyl)silyl]oxy-1-silyloxypentan-2-yl]oxy-ethenyl-dimethylsilane.
| Compound Name | [5-chloro-2-[ethenyl(dimethyl)silyl]oxy-1-silyloxypentan-2-yl]oxy-ethenyl-dimethylsilane |
|---|---|
| PubChem CID | 123218090 |
| Molecular Formula | C13H29ClO3Si3 |
| Molecular Weight | 353.08 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [5-chloro-2-[ethenyl(dimethyl)silyl]oxy-1-silyloxypentan-2-yl]oxy-ethenyl-dimethylsilane |
| SMILES | C=C[Si](C)(C)OC(CCCCl)(CO[SiH3])O[Si](C)(C)C=C |
| InChI | InChI=1S/C13H29ClO3Si3/c1-7-19(3,4)16-13(12-15-18,10-9-11-14)17-20(5,6)8-2/h7-8H,1-2,9-12H2,3-6,18H3 |
| InChIKey | UAWIBDVVNOHVBU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.08 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|