C20H44O3Si3 — CID 123721523
ethenyl-[2-[ethenyl(dimethyl)silyl]oxy-1-silyloxydodecan-2-yl]oxy-dimethylsilane (PubChem CID 123721523) has the molecular formula C20H44O3Si3 and a molecular weight of 416.83 g/mol. Its IUPAC name is ethenyl-[2-[ethenyl(dimethyl)silyl]oxy-1-silyloxydodecan-2-yl]oxy-dimethylsilane.
| Compound Name | ethenyl-[2-[ethenyl(dimethyl)silyl]oxy-1-silyloxydodecan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 123721523 |
| Molecular Formula | C20H44O3Si3 |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | ethenyl-[2-[ethenyl(dimethyl)silyl]oxy-1-silyloxydodecan-2-yl]oxy-dimethylsilane |
| SMILES | C=C[Si](C)(C)OC(CCCCCCCCCC)(CO[SiH3])O[Si](C)(C)C=C |
| InChI | InChI=1S/C20H44O3Si3/c1-8-11-12-13-14-15-16-17-18-20(19-21-24,22-25(4,5)9-2)23-26(6,7)10-3/h9-10H,2-3,8,11-19H2,1,4-7,24H3 |
| InChIKey | LPMPTIYSRVVHFD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|