About 2,2-dibutylhexoxysilane
2,2-dibutylhexoxysilane (PubChem CID 123695436) has the molecular formula C14H32OSi
and a molecular weight of 244.49 g/mol. Its IUPAC name is 2,2-dibutylhexoxysilane.
Molecular Properties
| Compound Name | 2,2-dibutylhexoxysilane |
| PubChem CID | 123695436 |
| Molecular Formula | C14H32OSi |
| Molecular Weight | 244.49 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2,2-dibutylhexoxysilane |
| SMILES | CCCCC(CCCC)(CCCC)CO[SiH3] |
| InChI | InChI=1S/C14H32OSi/c1-4-7-10-14(13-15-16,11-8-5-2)12-9-6-3/h4-13H2,1-3,16H3 |
| InChIKey | FYRAPWYMRYMSMD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dibutylhexoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibutylhexoxysilane?
The IUPAC name of 2,2-dibutylhexoxysilane (CID 123695436) is 2,2-dibutylhexoxysilane.
What is the SMILES notation for 2,2-dibutylhexoxysilane?
The canonical SMILES for 2,2-dibutylhexoxysilane is CCCCC(CCCC)(CCCC)CO[SiH3].
What is the InChIKey of 2,2-dibutylhexoxysilane?
The InChIKey is FYRAPWYMRYMSMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32OSi/c1-4-7-10-14(13-15-16,11-8-5-2)12-9-6-3/h4-13H2,1-3,16H3.
What are the key properties of 2,2-dibutylhexoxysilane?
2,2-dibutylhexoxysilane has a molecular weight of 244.49 g/mol, XLogP of 3.84, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibutylhexoxysilane is sourced from PubChem (CID 123695436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).