C28H60O4 — CID 159037908
4,4-bis(ethoxymethyl)heptane;5,5-bis(ethoxymethyl)nonane (PubChem CID 159037908) has the molecular formula C28H60O4 and a molecular weight of 460.78 g/mol. Its IUPAC name is 4,4-bis(ethoxymethyl)heptane;5,5-bis(ethoxymethyl)nonane.
| Compound Name | 4,4-bis(ethoxymethyl)heptane;5,5-bis(ethoxymethyl)nonane |
|---|---|
| PubChem CID | 159037908 |
| Molecular Formula | C28H60O4 |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.45 |
| IUPAC Name | 4,4-bis(ethoxymethyl)heptane;5,5-bis(ethoxymethyl)nonane |
| SMILES | CCCC(CCC)(COCC)COCC.CCCCC(CCCC)(COCC)COCC |
| InChI | InChI=1S/C15H32O2.C13H28O2/c1-5-9-11-15(12-10-6-2,13-16-7-3)14-17-8-4;1-5-9-13(10-6-2,11-14-7-3)12-15-8-4/h5-14H2,1-4H3;5-12H2,1-4H3 |
| InChIKey | JVRKEFVGEJQLJZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |