C17H34F2O — CID 118527073
8-(ethoxymethyl)-8-ethyl-3,3-difluoro-2,2-dimethyldecane (PubChem CID 118527073) has the molecular formula C17H34F2O and a molecular weight of 292.45 g/mol. Its IUPAC name is 8-(ethoxymethyl)-8-ethyl-3,3-difluoro-2,2-dimethyldecane.
| Compound Name | 8-(ethoxymethyl)-8-ethyl-3,3-difluoro-2,2-dimethyldecane |
|---|---|
| PubChem CID | 118527073 |
| Molecular Formula | C17H34F2O |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 8-(ethoxymethyl)-8-ethyl-3,3-difluoro-2,2-dimethyldecane |
| SMILES | CCOCC(CC)(CC)CCCCC(F)(F)C(C)(C)C |
| InChI | InChI=1S/C17H34F2O/c1-7-16(8-2,14-20-9-3)12-10-11-13-17(18,19)15(4,5)6/h7-14H2,1-6H3 |
| InChIKey | YWDZVRGCLFXPFF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|