C18H36F2O — CID 58275576
8-ethyl-3,3-difluoro-2,2-dimethyl-8-(propan-2-yloxymethyl)decane (PubChem CID 58275576) has the molecular formula C18H36F2O and a molecular weight of 306.48 g/mol. Its IUPAC name is 8-ethyl-3,3-difluoro-2,2-dimethyl-8-(propan-2-yloxymethyl)decane.
| Compound Name | 8-ethyl-3,3-difluoro-2,2-dimethyl-8-(propan-2-yloxymethyl)decane |
|---|---|
| PubChem CID | 58275576 |
| Molecular Formula | C18H36F2O |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 8-ethyl-3,3-difluoro-2,2-dimethyl-8-(propan-2-yloxymethyl)decane |
| SMILES | CCC(CC)(CCCCC(F)(F)C(C)(C)C)COC(C)C |
| InChI | InChI=1S/C18H36F2O/c1-8-17(9-2,14-21-15(3)4)12-10-11-13-18(19,20)16(5,6)7/h15H,8-14H2,1-7H3 |
| InChIKey | QKFRIIRBOWJRRT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|