C24H50 — CID 140610407
4,4,9,9-tetrapropyldodecane (PubChem CID 140610407) has the molecular formula C24H50 and a molecular weight of 338.66 g/mol. Its IUPAC name is 4,4,9,9-tetrapropyldodecane.
| Compound Name | 4,4,9,9-tetrapropyldodecane |
|---|---|
| PubChem CID | 140610407 |
| Molecular Formula | C24H50 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 338.39 |
| IUPAC Name | 4,4,9,9-tetrapropyldodecane |
| SMILES | CCCC(CCC)(CCC)CCCCC(CCC)(CCC)CCC |
| InChI | InChI=1S/C24H50/c1-7-15-23(16-8-2,17-9-3)21-13-14-22-24(18-10-4,19-11-5)20-12-6/h7-22H2,1-6H3 |
| InChIKey | XIXITCHIZIJIKI-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|