C33H68O6 — CID 151648189
1,1,1,21,21,21-hexamethoxy-11,11-dipropylhenicosane (PubChem CID 151648189) has the molecular formula C33H68O6 and a molecular weight of 560.90 g/mol. Its IUPAC name is 1,1,1,21,21,21-hexamethoxy-11,11-dipropylhenicosane.
| Compound Name | 1,1,1,21,21,21-hexamethoxy-11,11-dipropylhenicosane |
|---|---|
| PubChem CID | 151648189 |
| Molecular Formula | C33H68O6 |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 560.50 |
| IUPAC Name | 1,1,1,21,21,21-hexamethoxy-11,11-dipropylhenicosane |
| SMILES | CCCC(CCC)(CCCCCCCCCC(OC)(OC)OC)CCCCCCCCCC(OC)(OC)OC |
| InChI | InChI=1S/C33H68O6/c1-9-25-31(26-10-2,27-21-17-13-11-15-19-23-29-32(34-3,35-4)36-5)28-22-18-14-12-16-20-24-30-33(37-6,38-7)39-8/h9-30H2,1-8H3 |
| InChIKey | QTYKLNMRJCPBMS-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|