C15H32O6 — CID 161375349
1,1,1,9,9,9-hexamethoxynonane (PubChem CID 161375349) has the molecular formula C15H32O6 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1,1,1,9,9,9-hexamethoxynonane.
| Compound Name | 1,1,1,9,9,9-hexamethoxynonane |
|---|---|
| PubChem CID | 161375349 |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1,1,1,9,9,9-hexamethoxynonane |
| SMILES | COC(CCCCCCCC(OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C15H32O6/c1-16-14(17-2,18-3)12-10-8-7-9-11-13-15(19-4,20-5)21-6/h7-13H2,1-6H3 |
| InChIKey | VQZSZYPCNXKCRF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|