C17H36O4 — CID 159955501
ethene;10-ethoxy-1,1,1-trimethoxydecane (PubChem CID 159955501) has the molecular formula C17H36O4 and a molecular weight of 304.47 g/mol. Its IUPAC name is ethene;10-ethoxy-1,1,1-trimethoxydecane.
| Compound Name | ethene;10-ethoxy-1,1,1-trimethoxydecane |
|---|---|
| PubChem CID | 159955501 |
| Molecular Formula | C17H36O4 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | ethene;10-ethoxy-1,1,1-trimethoxydecane |
| SMILES | C=C.CCOCCCCCCCCCC(OC)(OC)OC |
| InChI | InChI=1S/C15H32O4.C2H4/c1-5-19-14-12-10-8-6-7-9-11-13-15(16-2,17-3)18-4;1-2/h5-14H2,1-4H3;1-2H2 |
| InChIKey | OCQWUUYUZVCYMI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|