C20H39F3 — CID 160800982
1,1,1-trifluoro-11,11-dipropyltetradecane (PubChem CID 160800982) has the molecular formula C20H39F3 and a molecular weight of 336.53 g/mol. Its IUPAC name is 1,1,1-trifluoro-11,11-dipropyltetradecane.
| Compound Name | 1,1,1-trifluoro-11,11-dipropyltetradecane |
|---|---|
| PubChem CID | 160800982 |
| Molecular Formula | C20H39F3 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | 1,1,1-trifluoro-11,11-dipropyltetradecane |
| SMILES | CCCC(CCC)(CCC)CCCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C20H39F3/c1-4-14-19(15-5-2,16-6-3)17-12-10-8-7-9-11-13-18-20(21,22)23/h4-18H2,1-3H3 |
| InChIKey | SDBIUFJVBKGJGQ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|