C12H26O3Si3 — CID 123823482
ethenyl-[1-[ethenyl(dimethyl)silyl]oxy-1-silyloxybut-3-enoxy]-dimethylsilane (PubChem CID 123823482) has the molecular formula C12H26O3Si3 and a molecular weight of 302.60 g/mol. Its IUPAC name is ethenyl-[1-[ethenyl(dimethyl)silyl]oxy-1-silyloxybut-3-enoxy]-dimethylsilane.
| Compound Name | ethenyl-[1-[ethenyl(dimethyl)silyl]oxy-1-silyloxybut-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123823482 |
| Molecular Formula | C12H26O3Si3 |
| Molecular Weight | 302.60 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | ethenyl-[1-[ethenyl(dimethyl)silyl]oxy-1-silyloxybut-3-enoxy]-dimethylsilane |
| SMILES | C=CCC(O[SiH3])(O[Si](C)(C)C=C)O[Si](C)(C)C=C |
| InChI | InChI=1S/C12H26O3Si3/c1-8-11-12(13-16,14-17(4,5)9-2)15-18(6,7)10-3/h8-10H,1-3,11H2,4-7,16H3 |
| InChIKey | QRCCXAAYPIUTNL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|