C13H32Si3 — CID 12727914
1,1-bis(trimethylsilyl)but-3-enyl-trimethylsilane (PubChem CID 12727914) has the molecular formula C13H32Si3 and a molecular weight of 272.66 g/mol. Its IUPAC name is 1,1-bis(trimethylsilyl)but-3-enyl-trimethylsilane.
| Compound Name | 1,1-bis(trimethylsilyl)but-3-enyl-trimethylsilane |
|---|---|
| PubChem CID | 12727914 |
| Molecular Formula | C13H32Si3 |
| Molecular Weight | 272.66 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1,1-bis(trimethylsilyl)but-3-enyl-trimethylsilane |
| SMILES | C=CCC([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H32Si3/c1-11-12-13(14(2,3)4,15(5,6)7)16(8,9)10/h11H,1,12H2,2-10H3 |
| InChIKey | IOJISFJHQPCZOJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|