C21H48O6Si6 — CID 162488566
1,1-bis[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy]prop-2-enoxy-[ethenyl(dimethyl)silyl]oxy-dimethylsilane (PubChem CID 162488566) has the molecular formula C21H48O6Si6 and a molecular weight of 565.13 g/mol. Its IUPAC name is 1,1-bis[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy]prop-2-enoxy-[ethenyl(dimethyl)silyl]oxy-dimethylsilane.
| Compound Name | 1,1-bis[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy]prop-2-enoxy-[ethenyl(dimethyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 162488566 |
| Molecular Formula | C21H48O6Si6 |
| Molecular Weight | 565.13 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 1,1-bis[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy]prop-2-enoxy-[ethenyl(dimethyl)silyl]oxy-dimethylsilane |
| SMILES | C=CC(O[Si](C)(C)O[Si](C)(C)C=C)(O[Si](C)(C)O[Si](C)(C)C=C)O[Si](C)(C)O[Si](C)(C)C=C |
| InChI | InChI=1S/C21H48O6Si6/c1-17-21(22-31(11,12)25-28(5,6)18-2,23-32(13,14)26-29(7,8)19-3)24-33(15,16)27-30(9,10)20-4/h17-20H,1-4H2,5-16H3 |
| InChIKey | RYSAUZOLWVKGQS-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.13 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|