C18H34O2Si3 — CID 158306246
(4-tert-butylphenyl)-[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 158306246) has the molecular formula C18H34O2Si3 and a molecular weight of 366.73 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | (4-tert-butylphenyl)-[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 158306246 |
| Molecular Formula | C18H34O2Si3 |
| Molecular Weight | 366.73 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (4-tert-butylphenyl)-[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H34O2Si3/c1-11-21(5,6)19-23(9,10)20-22(7,8)17-14-12-16(13-15-17)18(2,3)4/h11-15H,1H2,2-10H3 |
| InChIKey | MBLHOCIQNQMIPH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|