C18H48O6Si6 — CID 162488567
1,1-bis[[dimethyl(trimethylsilyloxy)silyl]oxy]prop-2-enoxy-dimethyl-trimethylsilyloxysilane (PubChem CID 162488567) has the molecular formula C18H48O6Si6 and a molecular weight of 529.09 g/mol. Its IUPAC name is 1,1-bis[[dimethyl(trimethylsilyloxy)silyl]oxy]prop-2-enoxy-dimethyl-trimethylsilyloxysilane.
| Compound Name | 1,1-bis[[dimethyl(trimethylsilyloxy)silyl]oxy]prop-2-enoxy-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 162488567 |
| Molecular Formula | C18H48O6Si6 |
| Molecular Weight | 529.09 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 1,1-bis[[dimethyl(trimethylsilyloxy)silyl]oxy]prop-2-enoxy-dimethyl-trimethylsilyloxysilane |
| SMILES | C=CC(O[Si](C)(C)O[Si](C)(C)C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H48O6Si6/c1-17-18(19-28(11,12)22-25(2,3)4,20-29(13,14)23-26(5,6)7)21-30(15,16)24-27(8,9)10/h17H,1H2,2-16H3 |
| InChIKey | KFOJKOZABJWGJK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.09 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|