C10H18OSi — CID 141458258
3-ethenylpenta-1,4-dien-3-yloxy(trimethyl)silane (PubChem CID 141458258) has the molecular formula C10H18OSi and a molecular weight of 182.34 g/mol. Its IUPAC name is 3-ethenylpenta-1,4-dien-3-yloxy(trimethyl)silane.
| Compound Name | 3-ethenylpenta-1,4-dien-3-yloxy(trimethyl)silane |
|---|---|
| PubChem CID | 141458258 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-ethenylpenta-1,4-dien-3-yloxy(trimethyl)silane |
| SMILES | C=CC(C=C)(C=C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H18OSi/c1-7-10(8-2,9-3)11-12(4,5)6/h7-9H,1-3H2,4-6H3 |
| InChIKey | XRPXTXBGPNAORI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|