C8H20O2Si2 — CID 20768600
dimethyl-prop-2-enoxy-trimethylsilyloxysilane (PubChem CID 20768600) has the molecular formula C8H20O2Si2 and a molecular weight of 204.42 g/mol. Its IUPAC name is dimethyl-prop-2-enoxy-trimethylsilyloxysilane.
| Compound Name | dimethyl-prop-2-enoxy-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 20768600 |
| Molecular Formula | C8H20O2Si2 |
| Molecular Weight | 204.42 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | dimethyl-prop-2-enoxy-trimethylsilyloxysilane |
| SMILES | C=CCO[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C8H20O2Si2/c1-7-8-9-12(5,6)10-11(2,3)4/h7H,1,8H2,2-6H3 |
| InChIKey | RUYFRHCJRLSKQU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|