C16H34O4Si3 — CID 173182244
ethenyl-[1-[ethenyl(dimethyl)silyl]oxy-4-(2-methylprop-2-enoxy)-1-silyloxybutoxy]-dimethylsilane (PubChem CID 173182244) has the molecular formula C16H34O4Si3 and a molecular weight of 374.70 g/mol. Its IUPAC name is ethenyl-[1-[ethenyl(dimethyl)silyl]oxy-4-(2-methylprop-2-enoxy)-1-silyloxybutoxy]-dimethylsilane.
| Compound Name | ethenyl-[1-[ethenyl(dimethyl)silyl]oxy-4-(2-methylprop-2-enoxy)-1-silyloxybutoxy]-dimethylsilane |
|---|---|
| PubChem CID | 173182244 |
| Molecular Formula | C16H34O4Si3 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | ethenyl-[1-[ethenyl(dimethyl)silyl]oxy-4-(2-methylprop-2-enoxy)-1-silyloxybutoxy]-dimethylsilane |
| SMILES | C=C[Si](C)(C)OC(CCCOCC(=C)C)(O[SiH3])O[Si](C)(C)C=C |
| InChI | InChI=1S/C16H34O4Si3/c1-9-22(5,6)19-16(18-21,20-23(7,8)10-2)12-11-13-17-14-15(3)4/h9-10H,1-3,11-14H2,4-8,21H3 |
| InChIKey | BTVFDPIQVKUFNH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|