C26H62O7Si6 — CID 87093098
trimethyl-[3-(2-methylprop-2-enoxy)propyl-[3-(2-methylprop-2-enoxy)propyl-bis(trimethylsilyloxy)silyl]oxy-trimethylsilyloxysilyl]oxysilane (PubChem CID 87093098) has the molecular formula C26H62O7Si6 and a molecular weight of 655.29 g/mol. Its IUPAC name is trimethyl-[3-(2-methylprop-2-enoxy)propyl-[3-(2-methylprop-2-enoxy)propyl-bis(trimethylsilyloxy)silyl]oxy-trimethylsilyloxysilyl]oxysilane.
| Compound Name | trimethyl-[3-(2-methylprop-2-enoxy)propyl-[3-(2-methylprop-2-enoxy)propyl-bis(trimethylsilyloxy)silyl]oxy-trimethylsilyloxysilyl]oxysilane |
|---|---|
| PubChem CID | 87093098 |
| Molecular Formula | C26H62O7Si6 |
| Molecular Weight | 655.29 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | trimethyl-[3-(2-methylprop-2-enoxy)propyl-[3-(2-methylprop-2-enoxy)propyl-bis(trimethylsilyloxy)silyl]oxy-trimethylsilyloxysilyl]oxysilane |
| SMILES | C=C(C)COCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](CCCOCC(=C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H62O7Si6/c1-25(2)23-27-19-17-21-38(29-34(5,6)7,30-35(8,9)10)33-39(31-36(11,12)13,32-37(14,15)16)22-18-20-28-24-26(3)4/h1,3,17-24H2,2,4-16H3 |
| InChIKey | UZKYHHQBQADHGE-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.29 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|