C25H52O10Si4 — CID 88718474
2-[[bis[[2-acetyloxyethyl(dimethyl)silyl]oxy]-[3-(2-methylprop-2-enoxy)propyl]silyl]oxy-dimethylsilyl]ethyl acetate (PubChem CID 88718474) has the molecular formula C25H52O10Si4 and a molecular weight of 625.03 g/mol. Its IUPAC name is 2-[[bis[[2-acetyloxyethyl(dimethyl)silyl]oxy]-[3-(2-methylprop-2-enoxy)propyl]silyl]oxy-dimethylsilyl]ethyl acetate.
| Compound Name | 2-[[bis[[2-acetyloxyethyl(dimethyl)silyl]oxy]-[3-(2-methylprop-2-enoxy)propyl]silyl]oxy-dimethylsilyl]ethyl acetate |
|---|---|
| PubChem CID | 88718474 |
| Molecular Formula | C25H52O10Si4 |
| Molecular Weight | 625.03 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | 2-[[bis[[2-acetyloxyethyl(dimethyl)silyl]oxy]-[3-(2-methylprop-2-enoxy)propyl]silyl]oxy-dimethylsilyl]ethyl acetate |
| SMILES | C=C(C)COCCC[Si](O[Si](C)(C)CCOC(C)=O)(O[Si](C)(C)CCOC(C)=O)O[Si](C)(C)CCOC(C)=O |
| InChI | InChI=1S/C25H52O10Si4/c1-22(2)21-29-13-12-17-39(33-36(6,7)18-14-30-23(3)26,34-37(8,9)19-15-31-24(4)27)35-38(10,11)20-16-32-25(5)28/h1,12-21H2,2-11H3 |
| InChIKey | ODSGRHQRUCVTIJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.03 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|