C4H14OSi3 — CID 151840915
disilanyloxy-ethenyl-dimethylsilane (PubChem CID 151840915) has the molecular formula C4H14OSi3 and a molecular weight of 162.41 g/mol. Its IUPAC name is disilanyloxy-ethenyl-dimethylsilane.
| Compound Name | disilanyloxy-ethenyl-dimethylsilane |
|---|---|
| PubChem CID | 151840915 |
| Molecular Formula | C4H14OSi3 |
| Molecular Weight | 162.41 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | disilanyloxy-ethenyl-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[SiH2][SiH3] |
| InChI | InChI=1S/C4H14OSi3/c1-4-8(2,3)5-7-6/h4H,1,7H2,2-3,6H3 |
| InChIKey | SGQGTFRALFEBQW-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.41 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|