C20H44O6Si4 — CID 158054807
ethenyl-[[ethenyl(dimethyl)silyl]oxymethoxy]-dimethylsilane;ethenyl-[[ethenyl(dimethyl)silyl]oxymethoxymethoxymethoxy]-dimethylsilane (PubChem CID 158054807) has the molecular formula C20H44O6Si4 and a molecular weight of 492.91 g/mol. Its IUPAC name is ethenyl-[[ethenyl(dimethyl)silyl]oxymethoxy]-dimethylsilane;ethenyl-[[ethenyl(dimethyl)silyl]oxymethoxymethoxymethoxy]-dimethylsilane.
| Compound Name | ethenyl-[[ethenyl(dimethyl)silyl]oxymethoxy]-dimethylsilane;ethenyl-[[ethenyl(dimethyl)silyl]oxymethoxymethoxymethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 158054807 |
| Molecular Formula | C20H44O6Si4 |
| Molecular Weight | 492.91 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | ethenyl-[[ethenyl(dimethyl)silyl]oxymethoxy]-dimethylsilane;ethenyl-[[ethenyl(dimethyl)silyl]oxymethoxymethoxymethoxy]-dimethylsilane |
| SMILES | C=C[Si](C)(C)OCOCOCO[Si](C)(C)C=C.C=C[Si](C)(C)OCO[Si](C)(C)C=C |
| InChI | InChI=1S/C11H24O4Si2.C9H20O2Si2/c1-7-16(3,4)14-10-12-9-13-11-15-17(5,6)8-2;1-7-12(3,4)10-9-11-13(5,6)8-2/h7-8H,1-2,9-11H2,3-6H3;7-8H,1-2,9H2,3-6H3 |
| InChIKey | FJXJAYCBUUTZHK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.91 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|