C8H20O2Si3 — CID 123155737
ethenyl-[ethenyl(dimethyl)silyl]oxy-methyl-methylsilyloxysilane (PubChem CID 123155737) has the molecular formula C8H20O2Si3 and a molecular weight of 232.50 g/mol. Its IUPAC name is ethenyl-[ethenyl(dimethyl)silyl]oxy-methyl-methylsilyloxysilane.
| Compound Name | ethenyl-[ethenyl(dimethyl)silyl]oxy-methyl-methylsilyloxysilane |
|---|---|
| PubChem CID | 123155737 |
| Molecular Formula | C8H20O2Si3 |
| Molecular Weight | 232.50 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | ethenyl-[ethenyl(dimethyl)silyl]oxy-methyl-methylsilyloxysilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(C=C)O[SiH2]C |
| InChI | InChI=1S/C8H20O2Si3/c1-7-12(4,5)10-13(6,8-2)9-11-3/h7-8H,1-2,11H2,3-6H3 |
| InChIKey | FCZQCTHYJVPARP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|