C25H64O7Si9 — CID 59957069
CID 59957069 (PubChem CID 59957069) has the molecular formula C25H64O7Si9 and a molecular weight of 729.55 g/mol.
| Compound Name | CID 59957069 |
|---|---|
| PubChem CID | 59957069 |
| Molecular Formula | C25H64O7Si9 |
| Molecular Weight | 729.55 g/mol |
| Exact Mass | 728.26 |
| IUPAC Name | — |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CC[Si](C)(C)O[Si](CCC)(O[Si](C)(C)CC[Si]OC)O[Si](C)(C)CC[Si]OC |
| InChI | InChI=1S/C25H64O7Si9/c1-17-21-41(30-36(7,8)22-19-33-26-3,31-37(9,10)23-20-34-27-4)32-39(13,14)25-24-38(11,12)29-40(15,16)28-35(5,6)18-2/h18H,2,17,19-25H2,1,3-16H3 |
| InChIKey | XDOGBLGBAKCRNK-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.55 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|