C10H25NSi3 — CID 101045068
[[dimethylsilyl-[ethenyl(dimethyl)silyl]amino]-dimethylsilyl]ethene (PubChem CID 101045068) has the molecular formula C10H25NSi3 and a molecular weight of 243.57 g/mol. Its IUPAC name is [[dimethylsilyl-[ethenyl(dimethyl)silyl]amino]-dimethylsilyl]ethene.
| Compound Name | [[dimethylsilyl-[ethenyl(dimethyl)silyl]amino]-dimethylsilyl]ethene |
|---|---|
| PubChem CID | 101045068 |
| Molecular Formula | C10H25NSi3 |
| Molecular Weight | 243.57 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | [[dimethylsilyl-[ethenyl(dimethyl)silyl]amino]-dimethylsilyl]ethene |
| SMILES | C=C[Si](C)(C)N([SiH](C)C)[Si](C)(C)C=C |
| InChI | InChI=1S/C10H25NSi3/c1-9-13(5,6)11(12(3)4)14(7,8)10-2/h9-10,12H,1-2H2,3-8H3 |
| InChIKey | YNWUMEPMQQLXOE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|