About ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane
ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane (PubChem CID 159931566) has the molecular formula C7H22O2Si2
and a molecular weight of 194.42 g/mol. Its IUPAC name is ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane.
Molecular Properties
| Compound Name | ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane |
| PubChem CID | 159931566 |
| Molecular Formula | C7H22O2Si2 |
| Molecular Weight | 194.42 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane |
| SMILES | CC[Si](C)(C)O.C[Si](C)(C)O |
| InChI | InChI=1S/C4H12OSi.C3H10OSi/c1-4-6(2,3)5;1-5(2,3)4/h5H,4H2,1-3H3;4H,1-3H3 |
| InChIKey | NZSAACLEFLPIBB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane?
The IUPAC name of ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane (CID 159931566) is ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane.
What is the SMILES notation for ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane?
The canonical SMILES for ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane is CC[Si](C)(C)O.C[Si](C)(C)O.
What is the InChIKey of ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane?
The InChIKey is NZSAACLEFLPIBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi.C3H10OSi/c1-4-6(2,3)5;1-5(2,3)4/h5H,4H2,1-3H3;4H,1-3H3.
What are the key properties of ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane?
ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane has a molecular weight of 194.42 g/mol, XLogP of 2.02, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-hydroxy-dimethylsilane;hydroxy(trimethyl)silane is sourced from PubChem (CID 159931566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).