About bis(hydroxy-dimethyl-propylsilane);sulfane
bis(hydroxy-dimethyl-propylsilane);sulfane (PubChem CID 87921130) has the molecular formula C10H30O2SSi2
and a molecular weight of 270.59 g/mol. Its IUPAC name is bis(hydroxy-dimethyl-propylsilane);sulfane.
Molecular Properties
| Compound Name | bis(hydroxy-dimethyl-propylsilane);sulfane |
| PubChem CID | 87921130 |
| Molecular Formula | C10H30O2SSi2 |
| Molecular Weight | 270.59 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | bis(hydroxy-dimethyl-propylsilane);sulfane |
| SMILES | CCC[Si](C)(C)O.CCC[Si](C)(C)O.S |
| InChI | InChI=1S/2C5H14OSi.H2S/c2*1-4-5-7(2,3)6;/h2*6H,4-5H2,1-3H3;1H2 |
| InChIKey | XQKDZYBMYOKVHL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(hydroxy-dimethyl-propylsilane);sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hydroxy-dimethyl-propylsilane);sulfane?
The IUPAC name of bis(hydroxy-dimethyl-propylsilane);sulfane (CID 87921130) is bis(hydroxy-dimethyl-propylsilane);sulfane.
What is the SMILES notation for bis(hydroxy-dimethyl-propylsilane);sulfane?
The canonical SMILES for bis(hydroxy-dimethyl-propylsilane);sulfane is CCC[Si](C)(C)O.CCC[Si](C)(C)O.S.
What is the InChIKey of bis(hydroxy-dimethyl-propylsilane);sulfane?
The InChIKey is XQKDZYBMYOKVHL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H14OSi.H2S/c2*1-4-5-7(2,3)6;/h2*6H,4-5H2,1-3H3;1H2.
What are the key properties of bis(hydroxy-dimethyl-propylsilane);sulfane?
bis(hydroxy-dimethyl-propylsilane);sulfane has a molecular weight of 270.59 g/mol, XLogP of 3.30, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hydroxy-dimethyl-propylsilane);sulfane is sourced from PubChem (CID 87921130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).