C8H24O4Si3 — CID 20640832
bis[[hydroxy(dimethyl)silyl]oxy]-methyl-propylsilane (PubChem CID 20640832) has the molecular formula C8H24O4Si3 and a molecular weight of 268.53 g/mol. Its IUPAC name is bis[[hydroxy(dimethyl)silyl]oxy]-methyl-propylsilane.
| Compound Name | bis[[hydroxy(dimethyl)silyl]oxy]-methyl-propylsilane |
|---|---|
| PubChem CID | 20640832 |
| Molecular Formula | C8H24O4Si3 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | bis[[hydroxy(dimethyl)silyl]oxy]-methyl-propylsilane |
| SMILES | CCC[Si](C)(O[Si](C)(C)O)O[Si](C)(C)O |
| InChI | InChI=1S/C8H24O4Si3/c1-7-8-15(6,11-13(2,3)9)12-14(4,5)10/h9-10H,7-8H2,1-6H3 |
| InChIKey | BONUSICBMQWXEE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|