C11H26O2Si2 — CID 87705691
trimethyl-[methyl-(2-methylprop-2-enoxy)-propylsilyl]oxysilane (PubChem CID 87705691) has the molecular formula C11H26O2Si2 and a molecular weight of 246.50 g/mol. Its IUPAC name is trimethyl-[methyl-(2-methylprop-2-enoxy)-propylsilyl]oxysilane.
| Compound Name | trimethyl-[methyl-(2-methylprop-2-enoxy)-propylsilyl]oxysilane |
|---|---|
| PubChem CID | 87705691 |
| Molecular Formula | C11H26O2Si2 |
| Molecular Weight | 246.50 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | trimethyl-[methyl-(2-methylprop-2-enoxy)-propylsilyl]oxysilane |
| SMILES | C=C(C)CO[Si](C)(CCC)O[Si](C)(C)C |
| InChI | InChI=1S/C11H26O2Si2/c1-8-9-15(7,12-10-11(2)3)13-14(4,5)6/h2,8-10H2,1,3-7H3 |
| InChIKey | SVGLMYITAMYWBW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|