C11H26O3Si2 — CID 88520936
(2-methylprop-2-enoxy-propyl-trimethylsilyloxysilyl)methanol (PubChem CID 88520936) has the molecular formula C11H26O3Si2 and a molecular weight of 262.50 g/mol. Its IUPAC name is (2-methylprop-2-enoxy-propyl-trimethylsilyloxysilyl)methanol.
| Compound Name | (2-methylprop-2-enoxy-propyl-trimethylsilyloxysilyl)methanol |
|---|---|
| PubChem CID | 88520936 |
| Molecular Formula | C11H26O3Si2 |
| Molecular Weight | 262.50 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2-methylprop-2-enoxy-propyl-trimethylsilyloxysilyl)methanol |
| SMILES | C=C(C)CO[Si](CO)(CCC)O[Si](C)(C)C |
| InChI | InChI=1S/C11H26O3Si2/c1-7-8-16(10-12,13-9-11(2)3)14-15(4,5)6/h12H,2,7-10H2,1,3-6H3 |
| InChIKey | CHTXIUYZWGYHQR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|