C17H42O4Si4 — CID 173035401
trimethyl-[[2-methylprop-2-enoxy(propyl)silyl]-bis(trimethylsilyloxy)methoxy]silane (PubChem CID 173035401) has the molecular formula C17H42O4Si4 and a molecular weight of 422.86 g/mol. Its IUPAC name is trimethyl-[[2-methylprop-2-enoxy(propyl)silyl]-bis(trimethylsilyloxy)methoxy]silane.
| Compound Name | trimethyl-[[2-methylprop-2-enoxy(propyl)silyl]-bis(trimethylsilyloxy)methoxy]silane |
|---|---|
| PubChem CID | 173035401 |
| Molecular Formula | C17H42O4Si4 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | trimethyl-[[2-methylprop-2-enoxy(propyl)silyl]-bis(trimethylsilyloxy)methoxy]silane |
| SMILES | C=C(C)CO[SiH](CCC)C(O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H42O4Si4/c1-13-14-22(18-15-16(2)3)17(19-23(4,5)6,20-24(7,8)9)21-25(10,11)12/h22H,2,13-15H2,1,3-12H3 |
| InChIKey | DFKZDRUTCSHHLA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|