C16H32O4Si3 — CID 21339181
ethenyl-[ethenyl-methyl-(methyl-prop-2-enoxy-propylsilyl)oxysilyl]oxy-methyl-prop-2-enoxysilane (PubChem CID 21339181) has the molecular formula C16H32O4Si3 and a molecular weight of 372.69 g/mol. Its IUPAC name is ethenyl-[ethenyl-methyl-(methyl-prop-2-enoxy-propylsilyl)oxysilyl]oxy-methyl-prop-2-enoxysilane.
| Compound Name | ethenyl-[ethenyl-methyl-(methyl-prop-2-enoxy-propylsilyl)oxysilyl]oxy-methyl-prop-2-enoxysilane |
|---|---|
| PubChem CID | 21339181 |
| Molecular Formula | C16H32O4Si3 |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | ethenyl-[ethenyl-methyl-(methyl-prop-2-enoxy-propylsilyl)oxysilyl]oxy-methyl-prop-2-enoxysilane |
| SMILES | C=CCO[Si](C)(C=C)O[Si](C)(C=C)O[Si](C)(CCC)OCC=C |
| InChI | InChI=1S/C16H32O4Si3/c1-9-14-17-21(6,12-4)19-22(7,13-5)20-23(8,16-11-3)18-15-10-2/h9-10,12-13H,1-2,4-5,11,14-16H2,3,6-8H3 |
| InChIKey | GDRYXONHHXSPCS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|