C26H50O6Si3 — CID 90911170
ethene;[(ethenyl-methyl-prop-2-enoxysilyl)oxy-methyl-(methyl-octyl-prop-2-enoxysilyl)oxysilyl]methyl 2-methylprop-2-enoate (PubChem CID 90911170) has the molecular formula C26H50O6Si3 and a molecular weight of 542.94 g/mol. Its IUPAC name is ethene;[(ethenyl-methyl-prop-2-enoxysilyl)oxy-methyl-(methyl-octyl-prop-2-enoxysilyl)oxysilyl]methyl 2-methylprop-2-enoate.
| Compound Name | ethene;[(ethenyl-methyl-prop-2-enoxysilyl)oxy-methyl-(methyl-octyl-prop-2-enoxysilyl)oxysilyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90911170 |
| Molecular Formula | C26H50O6Si3 |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | ethene;[(ethenyl-methyl-prop-2-enoxysilyl)oxy-methyl-(methyl-octyl-prop-2-enoxysilyl)oxysilyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C.C=CCO[Si](C)(C=C)O[Si](C)(COC(=O)C(=C)C)O[Si](C)(CCCCCCCC)OCC=C |
| InChI | InChI=1S/C24H46O6Si3.C2H4/c1-10-14-15-16-17-18-21-32(8,28-20-12-3)30-33(9,22-26-24(25)23(5)6)29-31(7,13-4)27-19-11-2;1-2/h11-13H,2-5,10,14-22H2,1,6-9H3;1-2H2 |
| InChIKey | LIYSNSGOYBMQCO-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|