C15H24F12O4Si3 — CID 21361130
3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodec-9-enyl-bis[[hydroxy(dimethyl)silyl]oxy]-methylsilane (PubChem CID 21361130) has the molecular formula C15H24F12O4Si3 and a molecular weight of 580.59 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodec-9-enyl-bis[[hydroxy(dimethyl)silyl]oxy]-methylsilane.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodec-9-enyl-bis[[hydroxy(dimethyl)silyl]oxy]-methylsilane |
|---|---|
| PubChem CID | 21361130 |
| Molecular Formula | C15H24F12O4Si3 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodec-9-enyl-bis[[hydroxy(dimethyl)silyl]oxy]-methylsilane |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](C)(O[Si](C)(C)O)O[Si](C)(C)O |
| InChI | InChI=1S/C15H24F12O4Si3/c1-7-10(16,17)12(20,21)14(24,25)15(26,27)13(22,23)11(18,19)8-9-34(6,30-32(2,3)28)31-33(4,5)29/h7,28-29H,1,8-9H2,2-6H3 |
| InChIKey | MYZZYILWVLPDJK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|