C6H2F13KO — CID 174272678
potassium;1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-ol;hydride (PubChem CID 174272678) has the molecular formula C6H2F13KO and a molecular weight of 376.15 g/mol. Its IUPAC name is potassium;1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-ol;hydride.
| Compound Name | potassium;1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-ol;hydride |
|---|---|
| PubChem CID | 174272678 |
| Molecular Formula | C6H2F13KO |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | potassium;1,1,1,3,4,4,4-heptafluoro-2,3-bis(trifluoromethyl)butan-2-ol;hydride |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F.[H-].[K+] |
| InChI | InChI=1S/C6HF13O.K.H/c7-1(3(8,9)10,4(11,12)13)2(20,5(14,15)16)6(17,18)19;;/h20H;;/q;+1;-1 |
| InChIKey | LIKYGAVJLXPCFT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |