C6F13 — CID 132604725
CID 132604725 (PubChem CID 132604725) has the molecular formula C6F13 and a molecular weight of 319.04 g/mol.
| Compound Name | CID 132604725 |
|---|---|
| PubChem CID | 132604725 |
| Molecular Formula | C6F13 |
| Molecular Weight | 319.04 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | — |
| SMILES | F[C](C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F13/c7-1(3(10,11)12)2(8,9)4(13,5(14,15)16)6(17,18)19 |
| InChIKey | RAUZDEYQOKWREY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.04 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |