C7H2F12O2 — CID 174793039
2-(difluoromethylidene)-1,1,3,4,5,5,5-heptafluoro-4-(trifluoromethyl)pentane-1,3-diol (PubChem CID 174793039) has the molecular formula C7H2F12O2 and a molecular weight of 346.07 g/mol. Its IUPAC name is 2-(difluoromethylidene)-1,1,3,4,5,5,5-heptafluoro-4-(trifluoromethyl)pentane-1,3-diol.
| Compound Name | 2-(difluoromethylidene)-1,1,3,4,5,5,5-heptafluoro-4-(trifluoromethyl)pentane-1,3-diol |
|---|---|
| PubChem CID | 174793039 |
| Molecular Formula | C7H2F12O2 |
| Molecular Weight | 346.07 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 2-(difluoromethylidene)-1,1,3,4,5,5,5-heptafluoro-4-(trifluoromethyl)pentane-1,3-diol |
| SMILES | OC(F)(F)C(=C(F)F)C(O)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H2F12O2/c8-2(9)1(4(11,12)21)3(10,20)5(13,6(14,15)16)7(17,18)19/h20-21H |
| InChIKey | BTIVDJZOPHUJLD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.07 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |