C9H3F17 — CID 89358349
1,1,1,2,3,3,4,5,6,6,6-undecafluoro-4-methyl-2,5-bis(trifluoromethyl)hexane (PubChem CID 89358349) has the molecular formula C9H3F17 and a molecular weight of 434.09 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,5,6,6,6-undecafluoro-4-methyl-2,5-bis(trifluoromethyl)hexane.
| Compound Name | 1,1,1,2,3,3,4,5,6,6,6-undecafluoro-4-methyl-2,5-bis(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 89358349 |
| Molecular Formula | C9H3F17 |
| Molecular Weight | 434.09 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 1,1,1,2,3,3,4,5,6,6,6-undecafluoro-4-methyl-2,5-bis(trifluoromethyl)hexane |
| SMILES | CC(F)(C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3F17/c1-2(10,3(11,6(15,16)17)7(18,19)20)5(13,14)4(12,8(21,22)23)9(24,25)26/h1H3 |
| InChIKey | OEYJGQMKWAWSNX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.09 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |