C7H8F6O3 — CID 89451216
[4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] formate (PubChem CID 89451216) has the molecular formula C7H8F6O3 and a molecular weight of 254.13 g/mol. Its IUPAC name is [4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] formate.
| Compound Name | [4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] formate |
|---|---|
| PubChem CID | 89451216 |
| Molecular Formula | C7H8F6O3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | [4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] formate |
| SMILES | CC(C)(OC=O)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6O3/c1-4(2,16-3-14)5(15,6(8,9)10)7(11,12)13/h3,15H,1-2H3 |
| InChIKey | GBOSCQWBEIDKBW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|