C15H25F6O5P — CID 23417059
1,1,1,3,3,3-hexafluoro-2-(2,2,3,3,7,7,8,8-octamethyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonan-5-yl)propan-2-ol (PubChem CID 23417059) has the molecular formula C15H25F6O5P and a molecular weight of 430.32 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2,2,3,3,7,7,8,8-octamethyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonan-5-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2,2,3,3,7,7,8,8-octamethyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonan-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 23417059 |
| Molecular Formula | C15H25F6O5P |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2,2,3,3,7,7,8,8-octamethyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonan-5-yl)propan-2-ol |
| SMILES | CC1(C)OP2(C(O)(C(F)(F)F)C(F)(F)F)(OC1(C)C)OC(C)(C)C(C)(C)O2 |
| InChI | InChI=1S/C15H25F6O5P/c1-9(2)10(3,4)24-27(23-9,25-11(5,6)12(7,8)26-27)13(22,14(16,17)18)15(19,20)21/h22H,1-8H3 |
| InChIKey | MAFMCMWEAMOAHU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|