C7HClF10O — CID 154154030
7-chloro-2,2,3,4,4,5,6-heptafluoro-5-(trifluoromethyl)-3H-oxepine (PubChem CID 154154030) has the molecular formula C7HClF10O and a molecular weight of 326.52 g/mol. Its IUPAC name is 7-chloro-2,2,3,4,4,5,6-heptafluoro-5-(trifluoromethyl)-3H-oxepine.
| Compound Name | 7-chloro-2,2,3,4,4,5,6-heptafluoro-5-(trifluoromethyl)-3H-oxepine |
|---|---|
| PubChem CID | 154154030 |
| Molecular Formula | C7HClF10O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 7-chloro-2,2,3,4,4,5,6-heptafluoro-5-(trifluoromethyl)-3H-oxepine |
| SMILES | FC1=C(Cl)OC(F)(F)C(F)C(F)(F)C1(F)C(F)(F)F |
| InChI | InChI=1S/C7HClF10O/c8-2-1(9)4(11,7(16,17)18)5(12,13)3(10)6(14,15)19-2/h3H |
| InChIKey | UXENOSBPYKESDS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |