C7H2F10 — CID 87708394
1,2,3,4,4,6,6-heptafluoro-3-(trifluoromethyl)cyclohexene (PubChem CID 87708394) has the molecular formula C7H2F10 and a molecular weight of 276.07 g/mol. Its IUPAC name is 1,2,3,4,4,6,6-heptafluoro-3-(trifluoromethyl)cyclohexene.
| Compound Name | 1,2,3,4,4,6,6-heptafluoro-3-(trifluoromethyl)cyclohexene |
|---|---|
| PubChem CID | 87708394 |
| Molecular Formula | C7H2F10 |
| Molecular Weight | 276.07 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 1,2,3,4,4,6,6-heptafluoro-3-(trifluoromethyl)cyclohexene |
| SMILES | FC1=C(F)C(F)(C(F)(F)F)C(F)(F)CC1(F)F |
| InChI | InChI=1S/C7H2F10/c8-2-3(9)6(14,7(15,16)17)5(12,13)1-4(2,10)11/h1H2 |
| InChIKey | ZTSHAUKUVMEXOR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.07 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |