C5HCl2F7O — CID 23262814
2,2-bis[chloro(difluoro)methyl]-3,4,4-trifluorooxetane (PubChem CID 23262814) has the molecular formula C5HCl2F7O and a molecular weight of 280.95 g/mol. Its IUPAC name is 2,2-bis[chloro(difluoro)methyl]-3,4,4-trifluorooxetane.
| Compound Name | 2,2-bis[chloro(difluoro)methyl]-3,4,4-trifluorooxetane |
|---|---|
| PubChem CID | 23262814 |
| Molecular Formula | C5HCl2F7O |
| Molecular Weight | 280.95 g/mol |
| Exact Mass | 279.93 |
| IUPAC Name | 2,2-bis[chloro(difluoro)methyl]-3,4,4-trifluorooxetane |
| SMILES | FC1C(F)(F)OC1(C(F)(F)Cl)C(F)(F)Cl |
| InChI | InChI=1S/C5HCl2F7O/c6-4(11,12)2(5(7,13)14)1(8)3(9,10)15-2/h1H |
| InChIKey | OMASCUHTNSOPQK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.95 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|