C5HClF8O2 — CID 23237419
(2R,5R)-2-[chloro(difluoro)methyl]-4,4,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane (PubChem CID 23237419) has the molecular formula C5HClF8O2 and a molecular weight of 280.50 g/mol. Its IUPAC name is (2R,5R)-2-[chloro(difluoro)methyl]-4,4,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane.
| Compound Name | (2R,5R)-2-[chloro(difluoro)methyl]-4,4,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 23237419 |
| Molecular Formula | C5HClF8O2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | (2R,5R)-2-[chloro(difluoro)methyl]-4,4,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane |
| SMILES | F[C@H]1O[C@@](C(F)(F)F)(C(F)(F)Cl)OC1(F)F |
| InChI | InChI=1S/C5HClF8O2/c6-4(10,11)3(5(12,13)14)15-1(7)2(8,9)16-3/h1H/t1-,3-/m0/s1 |
| InChIKey | RUSIMSXJHBGOMB-VRKGVYIXSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|